C34H37ClFNO6 — CID 126072273
3-[9-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126072273) has the molecular formula C34H37ClFNO6 and a molecular weight of 610.12 g/mol. Its IUPAC name is 3-[9-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126072273 |
| Molecular Formula | C34H37ClFNO6 |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | 3-[9-[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC(=O)O)C3=C2C(=O)CC(C)(C)C3)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C34H37ClFNO6/c1-33(2)14-23-30(25(38)16-33)29(31-24(37(23)11-10-28(40)41)15-34(3,4)17-26(31)39)20-12-22(35)32(27(13-20)42-5)43-18-19-6-8-21(36)9-7-19/h6-9,12-13,29H,10-11,14-18H2,1-5H3,(H,40,41) |
| InChIKey | NZRKEXMYPGQPJE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |