C33H34Cl3NO5 — CID 126073997
3-[9-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126073997) has the molecular formula C33H34Cl3NO5 and a molecular weight of 631.00 g/mol. Its IUPAC name is 3-[9-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126073997 |
| Molecular Formula | C33H34Cl3NO5 |
| Molecular Weight | 631.00 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | 3-[9-[3,5-dichloro-4-[(3-chlorophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)c(OCc2cccc(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C33H34Cl3NO5/c1-32(2)13-23-29(25(38)15-32)28(30-24(37(23)9-8-27(40)41)14-33(3,4)16-26(30)39)19-11-21(35)31(22(36)12-19)42-17-18-6-5-7-20(34)10-18/h5-7,10-12,28H,8-9,13-17H2,1-4H3,(H,40,41) |
| InChIKey | GJEYDGQPRPZWII-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.00 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |