C31H31Cl2NO6 — CID 126080692
3-[9-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126080692) has the molecular formula C31H31Cl2NO6 and a molecular weight of 584.50 g/mol. Its IUPAC name is 3-[9-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126080692 |
| Molecular Formula | C31H31Cl2NO6 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | 3-[9-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(Cl)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C31H31Cl2NO6/c1-2-39-26-16-19(15-21(33)31(26)40-17-18-6-3-7-20(32)14-18)28-29-22(8-4-10-24(29)35)34(13-12-27(37)38)23-9-5-11-25(36)30(23)28/h3,6-7,14-16,28H,2,4-5,8-13,17H2,1H3,(H,37,38) |
| InChIKey | ZBLTXZCNVPKJNR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |