C30H28Cl3NO6 — CID 4764472
2-[9-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 4764472) has the molecular formula C30H28Cl3NO6 and a molecular weight of 604.91 g/mol. Its IUPAC name is 2-[9-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 4764472 |
| Molecular Formula | C30H28Cl3NO6 |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | 2-[9-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H28Cl3NO6/c1-2-39-25-12-17(11-20(33)30(25)40-15-16-9-10-18(31)13-19(16)32)27-28-21(5-3-7-23(28)35)34(14-26(37)38)22-6-4-8-24(36)29(22)27/h9-13,27H,2-8,14-15H2,1H3,(H,37,38) |
| InChIKey | VUZIEUNLPGDDBM-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |