C23H24ClNO5 — CID 4764417
2-[9-(3-chloro-4-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 4764417) has the molecular formula C23H24ClNO5 and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-[9-(3-chloro-4-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-(3-chloro-4-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 4764417 |
| Molecular Formula | C23H24ClNO5 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-[9-(3-chloro-4-ethoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | CCOc1ccc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc1Cl |
| InChI | InChI=1S/C23H24ClNO5/c1-2-30-19-10-9-13(11-14(19)24)21-22-15(5-3-7-17(22)26)25(12-20(28)29)16-6-4-8-18(27)23(16)21/h9-11,21H,2-8,12H2,1H3,(H,28,29) |
| InChIKey | MYZPHJBEKITGCL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |