C29H27BrClNO5 — CID 126078034
3-[9-[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126078034) has the molecular formula C29H27BrClNO5 and a molecular weight of 584.89 g/mol. Its IUPAC name is 3-[9-[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126078034 |
| Molecular Formula | C29H27BrClNO5 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | 3-[9-[4-[(4-bromophenyl)methoxy]-3-chlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2ccc(OCc3ccc(Br)cc3)c(Cl)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H27BrClNO5/c30-19-10-7-17(8-11-19)16-37-25-12-9-18(15-20(25)31)27-28-21(3-1-5-23(28)33)32(14-13-26(35)36)22-4-2-6-24(34)29(22)27/h7-12,15,27H,1-6,13-14,16H2,(H,35,36) |
| InChIKey | KWQARFPUMKFQDB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |