C28H24BrCl2NO5 — CID 126052239
2-[9-[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126052239) has the molecular formula C28H24BrCl2NO5 and a molecular weight of 605.31 g/mol. Its IUPAC name is 2-[9-[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126052239 |
| Molecular Formula | C28H24BrCl2NO5 |
| Molecular Weight | 605.31 g/mol |
| Exact Mass | 603.02 |
| IUPAC Name | 2-[9-[4-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | O=C(O)CN1C2=C(C(=O)CCC2)C(c2cc(Cl)c(OCc3ccc(Br)cc3)c(Cl)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H24BrCl2NO5/c29-17-9-7-15(8-10-17)14-37-28-18(30)11-16(12-19(28)31)25-26-20(3-1-5-22(26)33)32(13-24(35)36)21-4-2-6-23(34)27(21)25/h7-12,25H,1-6,13-14H2,(H,35,36) |
| InChIKey | IEVTXLUFFYFRKJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.31 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |