C28H23Br2Cl2NO5 — CID 126053618
2-[9-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126053618) has the molecular formula C28H23Br2Cl2NO5 and a molecular weight of 684.21 g/mol. Its IUPAC name is 2-[9-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126053618 |
| Molecular Formula | C28H23Br2Cl2NO5 |
| Molecular Weight | 684.21 g/mol |
| Exact Mass | 680.93 |
| IUPAC Name | 2-[9-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | O=C(O)CN1C2=C(C(=O)CCC2)C(c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C28H23Br2Cl2NO5/c29-17-9-15(10-18(30)28(17)38-13-14-7-8-16(31)11-19(14)32)25-26-20(3-1-5-22(26)34)33(12-24(36)37)21-4-2-6-23(35)27(21)25/h7-11,25H,1-6,12-13H2,(H,36,37) |
| InChIKey | NRMBPOMZQOMTFH-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.21 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |