C29H27Cl2NO5 — CID 126072298
3-[9-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126072298) has the molecular formula C29H27Cl2NO5 and a molecular weight of 540.44 g/mol. Its IUPAC name is 3-[9-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126072298 |
| Molecular Formula | C29H27Cl2NO5 |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 3-[9-[5-chloro-2-[(2-chlorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2cc(Cl)ccc2OCc2ccccc2Cl)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H27Cl2NO5/c30-18-11-12-25(37-16-17-5-1-2-6-20(17)31)19(15-18)27-28-21(7-3-9-23(28)33)32(14-13-26(35)36)22-8-4-10-24(34)29(22)27/h1-2,5-6,11-12,15,27H,3-4,7-10,13-14,16H2,(H,35,36) |
| InChIKey | JKQPMKIMYKQMFB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |