C30H29FINO6 — CID 126078174
3-[9-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126078174) has the molecular formula C30H29FINO6 and a molecular weight of 645.47 g/mol. Its IUPAC name is 3-[9-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126078174 |
| Molecular Formula | C30H29FINO6 |
| Molecular Weight | 645.47 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | 3-[9-[4-[(2-fluorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C30H29FINO6/c1-38-25-15-18(14-20(32)30(25)39-16-17-6-2-3-7-19(17)31)27-28-21(8-4-10-23(28)34)33(13-12-26(36)37)22-9-5-11-24(35)29(22)27/h2-3,6-7,14-15,27H,4-5,8-13,16H2,1H3,(H,36,37) |
| InChIKey | PYPUFCSXYKRBFP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|