C33H30FNO5 — CID 126069270
3-[9-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126069270) has the molecular formula C33H30FNO5 and a molecular weight of 539.60 g/mol. Its IUPAC name is 3-[9-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126069270 |
| Molecular Formula | C33H30FNO5 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 3-[9-[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2c(OCc3ccccc3F)ccc3ccccc23)C2=C1CCCC2=O |
| InChI | InChI=1S/C33H30FNO5/c34-23-10-4-2-8-21(23)19-40-28-16-15-20-7-1-3-9-22(20)30(28)33-31-24(11-5-13-26(31)36)35(18-17-29(38)39)25-12-6-14-27(37)32(25)33/h1-4,7-10,15-16,33H,5-6,11-14,17-19H2,(H,38,39) |
| InChIKey | CKAQOHBFIJTVLX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |