C34H33NO5 — CID 126076749
3-[9-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126076749) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is 3-[9-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126076749 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | 3-[9-[2-[(4-methylphenyl)methoxy]naphthalen-1-yl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | Cc1ccc(COc2ccc3ccccc3c2C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C34H33NO5/c1-21-12-14-22(15-13-21)20-40-29-17-16-23-6-2-3-7-24(23)31(29)34-32-25(8-4-10-27(32)36)35(19-18-30(38)39)26-9-5-11-28(37)33(26)34/h2-3,6-7,12-17,34H,4-5,8-11,18-20H2,1H3,(H,38,39) |
| InChIKey | YXYVJQKRBCFMTM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |