C29H28FNO5 — CID 126076114
3-[9-[3-[(4-fluorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126076114) has the molecular formula C29H28FNO5 and a molecular weight of 489.54 g/mol. Its IUPAC name is 3-[9-[3-[(4-fluorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3-[(4-fluorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126076114 |
| Molecular Formula | C29H28FNO5 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 3-[9-[3-[(4-fluorophenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | O=C(O)CCN1C2=C(C(=O)CCC2)C(c2cccc(OCc3ccc(F)cc3)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H28FNO5/c30-20-12-10-18(11-13-20)17-36-21-5-1-4-19(16-21)27-28-22(6-2-8-24(28)32)31(15-14-26(34)35)23-7-3-9-25(33)29(23)27/h1,4-5,10-13,16,27H,2-3,6-9,14-15,17H2,(H,34,35) |
| InChIKey | WASBXNKFNGIMOG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |