C30H29Cl2NO5 — CID 126071002
3-[9-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126071002) has the molecular formula C30H29Cl2NO5 and a molecular weight of 554.47 g/mol. Its IUPAC name is 3-[9-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126071002 |
| Molecular Formula | C30H29Cl2NO5 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 3-[9-[3,5-dichloro-4-[(4-methylphenyl)methoxy]phenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | Cc1ccc(COc2c(Cl)cc(C3C4=C(CCCC4=O)N(CCC(=O)O)C4=C3C(=O)CCC4)cc2Cl)cc1 |
| InChI | InChI=1S/C30H29Cl2NO5/c1-17-8-10-18(11-9-17)16-38-30-20(31)14-19(15-21(30)32)27-28-22(4-2-6-24(28)34)33(13-12-26(36)37)23-5-3-7-25(35)29(23)27/h8-11,14-15,27H,2-7,12-13,16H2,1H3,(H,36,37) |
| InChIKey | IEKPPEWGRWPVRD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |