C25H29NO6 — CID 126080190
3-[9-(3-ethoxy-4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126080190) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[9-(3-ethoxy-4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-(3-ethoxy-4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126080190 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-[9-(3-ethoxy-4-methoxyphenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)ccc1OC |
| InChI | InChI=1S/C25H29NO6/c1-3-32-21-14-15(10-11-20(21)31-2)23-24-16(6-4-8-18(24)27)26(13-12-22(29)30)17-7-5-9-19(28)25(17)23/h10-11,14,23H,3-9,12-13H2,1-2H3,(H,29,30) |
| InChIKey | ITSCFOWCVHWGIL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |