C30H31NO8S — CID 126079840
3-[9-[4-(benzenesulfonyloxy)-3-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126079840) has the molecular formula C30H31NO8S and a molecular weight of 565.64 g/mol. Its IUPAC name is 3-[9-[4-(benzenesulfonyloxy)-3-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(benzenesulfonyloxy)-3-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126079840 |
| Molecular Formula | C30H31NO8S |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | 3-[9-[4-(benzenesulfonyloxy)-3-ethoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CCOc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31NO8S/c1-2-38-26-18-19(14-15-25(26)39-40(36,37)20-8-4-3-5-9-20)28-29-21(10-6-12-23(29)32)31(17-16-27(34)35)22-11-7-13-24(33)30(22)28/h3-5,8-9,14-15,18,28H,2,6-7,10-13,16-17H2,1H3,(H,34,35) |
| InChIKey | NKEPHJYTAGSDFS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|