C32H34ClNO7S — CID 126074356
3-[9-[4-(benzenesulfonyloxy)-3-chlorophenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126074356) has the molecular formula C32H34ClNO7S and a molecular weight of 612.14 g/mol. Its IUPAC name is 3-[9-[4-(benzenesulfonyloxy)-3-chlorophenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(benzenesulfonyloxy)-3-chlorophenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126074356 |
| Molecular Formula | C32H34ClNO7S |
| Molecular Weight | 612.14 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 3-[9-[4-(benzenesulfonyloxy)-3-chlorophenyl]-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(CCC(=O)O)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(OS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C32H34ClNO7S/c1-31(2)15-22-29(24(35)17-31)28(30-23(34(22)13-12-27(37)38)16-32(3,4)18-25(30)36)19-10-11-26(21(33)14-19)41-42(39,40)20-8-6-5-7-9-20/h5-11,14,28H,12-13,15-18H2,1-4H3,(H,37,38) |
| InChIKey | FDTGRCSRNORIDZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.14 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|