C35H43NO7S — CID 126076684
[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] benzenesulfonate (PubChem CID 126076684) has the molecular formula C35H43NO7S and a molecular weight of 621.80 g/mol. Its IUPAC name is [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126076684 |
| Molecular Formula | C35H43NO7S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H43NO7S/c1-7-42-30-18-23(14-15-29(30)43-44(39,40)24-12-9-8-10-13-24)31-32-25(19-34(2,3)21-27(32)37)36(16-11-17-41-6)26-20-35(4,5)22-28(38)33(26)31/h8-10,12-15,18,31H,7,11,16-17,19-22H2,1-6H3 |
| InChIKey | ZVBQWJJWXVBCIM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|