C39H49NO7S — CID 126082192
[2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate (PubChem CID 126082192) has the molecular formula C39H49NO7S and a molecular weight of 675.89 g/mol. Its IUPAC name is [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126082192 |
| Molecular Formula | C39H49NO7S |
| Molecular Weight | 675.89 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | [2-ethoxy-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C39H49NO7S/c1-9-12-26-19-27(20-33(46-10-2)37(26)47-48(43,44)28-15-13-25(3)14-16-28)34-35-29(21-38(4,5)23-31(35)41)40(17-11-18-45-8)30-22-39(6,7)24-32(42)36(30)34/h9,13-16,19-20,34H,1,10-12,17-18,21-24H2,2-8H3 |
| InChIKey | UPEUVYUSNYPIQC-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.89 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|