C33H35NO8S — CID 126071154
2-[9-[3-ethoxy-4-(4-methylphenyl)sulfonyloxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126071154) has the molecular formula C33H35NO8S and a molecular weight of 605.71 g/mol. Its IUPAC name is 2-[9-[3-ethoxy-4-(4-methylphenyl)sulfonyloxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[3-ethoxy-4-(4-methylphenyl)sulfonyloxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126071154 |
| Molecular Formula | C33H35NO8S |
| Molecular Weight | 605.71 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | 2-[9-[3-ethoxy-4-(4-methylphenyl)sulfonyloxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(OCC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H35NO8S/c1-4-8-21-17-22(18-28(41-5-2)33(21)42-43(39,40)23-15-13-20(3)14-16-23)30-31-24(9-6-11-26(31)35)34(19-29(37)38)25-10-7-12-27(36)32(25)30/h4,13-18,30H,1,5-12,19H2,2-3H3,(H,37,38) |
| InChIKey | FKQBZSHLVRVOIM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|