C33H34ClNO8S — CID 126071805
3-[9-[4-(4-chlorophenyl)sulfonyloxy-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid (PubChem CID 126071805) has the molecular formula C33H34ClNO8S and a molecular weight of 640.15 g/mol. Its IUPAC name is 3-[9-[4-(4-chlorophenyl)sulfonyloxy-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid.
| Compound Name | 3-[9-[4-(4-chlorophenyl)sulfonyloxy-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
|---|---|
| PubChem CID | 126071805 |
| Molecular Formula | C33H34ClNO8S |
| Molecular Weight | 640.15 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | 3-[9-[4-(4-chlorophenyl)sulfonyloxy-3-ethoxy-5-prop-2-enylphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]propanoic acid |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CCC(=O)O)C3=C2C(=O)CCC3)cc(OCC)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H34ClNO8S/c1-3-7-20-18-21(19-28(42-4-2)33(20)43-44(40,41)23-14-12-22(34)13-15-23)30-31-24(8-5-10-26(31)36)35(17-16-29(38)39)25-9-6-11-27(37)32(25)30/h3,12-15,18-19,30H,1,4-11,16-17H2,2H3,(H,38,39) |
| InChIKey | LQBKNUYPWFWHSU-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.15 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|