C28H25ClINO8S — CID 126077306
2-[9-[4-(4-chlorophenyl)sulfonyloxy-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid (PubChem CID 126077306) has the molecular formula C28H25ClINO8S and a molecular weight of 697.93 g/mol. Its IUPAC name is 2-[9-[4-(4-chlorophenyl)sulfonyloxy-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid.
| Compound Name | 2-[9-[4-(4-chlorophenyl)sulfonyloxy-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
|---|---|
| PubChem CID | 126077306 |
| Molecular Formula | C28H25ClINO8S |
| Molecular Weight | 697.93 g/mol |
| Exact Mass | 697.00 |
| IUPAC Name | 2-[9-[4-(4-chlorophenyl)sulfonyloxy-3-iodo-5-methoxyphenyl]-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-10-yl]acetic acid |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(CC(=O)O)C3=C2C(=O)CCC3)cc(I)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H25ClINO8S/c1-38-23-13-15(12-18(30)28(23)39-40(36,37)17-10-8-16(29)9-11-17)25-26-19(4-2-6-21(26)32)31(14-24(34)35)20-5-3-7-22(33)27(20)25/h8-13,25H,2-7,14H2,1H3,(H,34,35) |
| InChIKey | HLHLXWPELZQTST-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.93 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|