C26H23IO7S — CID 126080408
[4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-iodo-6-methoxyphenyl] benzenesulfonate (PubChem CID 126080408) has the molecular formula C26H23IO7S and a molecular weight of 606.43 g/mol. Its IUPAC name is [4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-iodo-6-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-iodo-6-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126080408 |
| Molecular Formula | C26H23IO7S |
| Molecular Weight | 606.43 g/mol |
| Exact Mass | 606.02 |
| IUPAC Name | [4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)-2-iodo-6-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(I)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23IO7S/c1-32-22-14-15(13-17(27)26(22)34-35(30,31)16-7-3-2-4-8-16)23-24-18(28)9-5-11-20(24)33-21-12-6-10-19(29)25(21)23/h2-4,7-8,13-14,23H,5-6,9-12H2,1H3 |
| InChIKey | ROONEUFZUGYKRE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|