C25H21BrO6S — CID 126073262
[2-bromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate (PubChem CID 126073262) has the molecular formula C25H21BrO6S and a molecular weight of 529.41 g/mol. Its IUPAC name is [2-bromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate.
| Compound Name | [2-bromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126073262 |
| Molecular Formula | C25H21BrO6S |
| Molecular Weight | 529.41 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | [2-bromo-4-(1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-xanthen-9-yl)phenyl] benzenesulfonate |
| SMILES | O=C1CCCC2=C1C(c1ccc(OS(=O)(=O)c3ccccc3)c(Br)c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C25H21BrO6S/c26-17-14-15(12-13-20(17)32-33(29,30)16-6-2-1-3-7-16)23-24-18(27)8-4-10-21(24)31-22-11-5-9-19(28)25(22)23/h1-3,6-7,12-14,23H,4-5,8-11H2 |
| InChIKey | MXCYROYDSLFCBV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|