C30H32BrNO5S — CID 126072739
[2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126072739) has the molecular formula C30H32BrNO5S and a molecular weight of 598.56 g/mol. Its IUPAC name is [2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126072739 |
| Molecular Formula | C30H32BrNO5S |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | [2-bromo-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C3C4=C(CC(C)(C)CC4=O)NC4=C3C(=O)CC(C)(C)C4)cc2Br)cc1 |
| InChI | InChI=1S/C30H32BrNO5S/c1-17-6-9-19(10-7-17)38(35,36)37-25-11-8-18(12-20(25)31)26-27-21(13-29(2,3)15-23(27)33)32-22-14-30(4,5)16-24(34)28(22)26/h6-12,26,32H,13-16H2,1-5H3 |
| InChIKey | OHTUMNMAKVDEGJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|