C34H39NO6S — CID 126078724
[2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126078724) has the molecular formula C34H39NO6S and a molecular weight of 589.75 g/mol. Its IUPAC name is [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126078724 |
| Molecular Formula | C34H39NO6S |
| Molecular Weight | 589.75 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-2,4,5,7,9,10-hexahydroacridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H39NO6S/c1-8-9-21-14-22(15-28(40-7)32(21)41-42(38,39)23-12-10-20(2)11-13-23)29-30-24(16-33(3,4)18-26(30)36)35-25-17-34(5,6)19-27(37)31(25)29/h8,10-15,29,35H,1,9,16-19H2,2-7H3 |
| InChIKey | BUEPTPVDVYBFOJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|