C36H42ClNO7S — CID 126077428
[2-methoxy-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate (PubChem CID 126077428) has the molecular formula C36H42ClNO7S and a molecular weight of 668.25 g/mol. Its IUPAC name is [2-methoxy-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-methoxy-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126077428 |
| Molecular Formula | C36H42ClNO7S |
| Molecular Weight | 668.25 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | [2-methoxy-4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]-6-prop-2-enylphenyl] 4-chlorobenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCOC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H42ClNO7S/c1-8-9-22-16-23(17-30(44-7)34(22)45-46(41,42)25-12-10-24(37)11-13-25)31-32-26(18-35(2,3)20-28(32)39)38(14-15-43-6)27-19-36(4,5)21-29(40)33(27)31/h8,10-13,16-17,31H,1,9,14-15,18-21H2,2-7H3 |
| InChIKey | IESMGHONLVCACE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.25 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|