C32H36ClNO6S — CID 126080958
[4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126080958) has the molecular formula C32H36ClNO6S and a molecular weight of 598.16 g/mol. Its IUPAC name is [4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126080958 |
| Molecular Formula | C32H36ClNO6S |
| Molecular Weight | 598.16 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | [4-[10-(2-methoxyethyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)cc2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H36ClNO6S/c1-31(2)16-24-29(26(35)18-31)28(30-25(34(24)14-15-39-5)17-32(3,4)19-27(30)36)20-6-10-22(11-7-20)40-41(37,38)23-12-8-21(33)9-13-23/h6-13,28H,14-19H2,1-5H3 |
| InChIKey | NCKDMRXVGAJRGZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.16 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|