C31H34ClNO6S — CID 126074790
[2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126074790) has the molecular formula C31H34ClNO6S and a molecular weight of 584.13 g/mol. Its IUPAC name is [2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126074790 |
| Molecular Formula | C31H34ClNO6S |
| Molecular Weight | 584.13 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | [2-methoxy-4-(3,3,6,6,10-pentamethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)N(C)C3=C2C(=O)CC(C)(C)C3)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34ClNO6S/c1-30(2)14-21-28(23(34)16-30)27(29-22(33(21)5)15-31(3,4)17-24(29)35)18-7-12-25(26(13-18)38-6)39-40(36,37)20-10-8-19(32)9-11-20/h7-13,27H,14-17H2,1-6H3 |
| InChIKey | RJKBGYPULMKRCY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.13 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|