C33H38ClNO6S — CID 126076984
[3-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076984) has the molecular formula C33H38ClNO6S and a molecular weight of 612.19 g/mol. Its IUPAC name is [3-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [3-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076984 |
| Molecular Formula | C33H38ClNO6S |
| Molecular Weight | 612.19 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | [3-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C33H38ClNO6S/c1-32(2)17-25-30(27(36)19-32)29(31-26(35(25)14-7-15-40-5)18-33(3,4)20-28(31)37)21-8-6-9-23(16-21)41-42(38,39)24-12-10-22(34)11-13-24/h6,8-13,16,29H,7,14-15,17-20H2,1-5H3 |
| InChIKey | CRISNJGDDVBAKE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.19 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|