C35H41ClINO7S — CID 126076112
[2-ethoxy-6-iodo-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076112) has the molecular formula C35H41ClINO7S and a molecular weight of 782.14 g/mol. Its IUPAC name is [2-ethoxy-6-iodo-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-ethoxy-6-iodo-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076112 |
| Molecular Formula | C35H41ClINO7S |
| Molecular Weight | 782.14 g/mol |
| Exact Mass | 781.13 |
| IUPAC Name | [2-ethoxy-6-iodo-4-[10-(3-methoxypropyl)-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)cc(I)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H41ClINO7S/c1-7-44-29-16-21(15-24(37)33(29)45-46(41,42)23-11-9-22(36)10-12-23)30-31-25(17-34(2,3)19-27(31)39)38(13-8-14-43-6)26-18-35(4,5)20-28(40)32(26)30/h9-12,15-16,30H,7-8,13-14,17-20H2,1-6H3 |
| InChIKey | VZVKMBXCPFNHFQ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.14 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|