C31H33Cl2NO5S — CID 126076039
[2-chloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076039) has the molecular formula C31H33Cl2NO5S and a molecular weight of 602.58 g/mol. Its IUPAC name is [2-chloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076039 |
| Molecular Formula | C31H33Cl2NO5S |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | [2-chloro-4-(10-ethyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C31H33Cl2NO5S/c1-6-34-22-14-30(2,3)16-24(35)28(22)27(29-23(34)15-31(4,5)17-25(29)36)18-7-12-26(21(33)13-18)39-40(37,38)20-10-8-19(32)9-11-20/h7-13,27H,6,14-17H2,1-5H3 |
| InChIKey | WSJSKMXEORZNCF-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|