C36H35Cl2NO5S — CID 126079478
[4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenyl] benzenesulfonate (PubChem CID 126079478) has the molecular formula C36H35Cl2NO5S and a molecular weight of 664.65 g/mol. Its IUPAC name is [4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenyl] benzenesulfonate.
| Compound Name | [4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126079478 |
| Molecular Formula | C36H35Cl2NO5S |
| Molecular Weight | 664.65 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | [4-(10-benzyl-3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-acridin-9-yl)-2,6-dichlorophenyl] benzenesulfonate |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(Cc1ccccc1)C1=C(C(=O)CC(C)(C)C1)C2c1cc(Cl)c(OS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C36H35Cl2NO5S/c1-35(2)17-27-32(29(40)19-35)31(23-15-25(37)34(26(38)16-23)44-45(42,43)24-13-9-6-10-14-24)33-28(18-36(3,4)20-30(33)41)39(27)21-22-11-7-5-8-12-22/h5-16,31H,17-21H2,1-4H3 |
| InChIKey | VANFYKFCUIWJLU-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.65 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|