C38H38ClN3O8 — CID 126093259
10-benzyl-9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126093259) has the molecular formula C38H38ClN3O8 and a molecular weight of 700.19 g/mol. Its IUPAC name is 10-benzyl-9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-benzyl-9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126093259 |
| Molecular Formula | C38H38ClN3O8 |
| Molecular Weight | 700.19 g/mol |
| Exact Mass | 699.23 |
| IUPAC Name | 10-benzyl-9-[3-chloro-4-(2,4-dinitrophenoxy)-5-ethoxyphenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(Cc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C38H38ClN3O8/c1-6-49-32-15-23(14-25(39)36(32)50-31-13-12-24(41(45)46)16-26(31)42(47)48)33-34-27(17-37(2,3)19-29(34)43)40(21-22-10-8-7-9-11-22)28-18-38(4,5)20-30(44)35(28)33/h7-16,33H,6,17-21H2,1-5H3 |
| InChIKey | XHJHBVBIHJYWMV-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.19 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|