C41H43N3O8 — CID 126084592
9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126084592) has the molecular formula C41H43N3O8 and a molecular weight of 705.81 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126084592 |
| Molecular Formula | C41H43N3O8 |
| Molecular Weight | 705.81 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)-3-methoxy-5-prop-2-enylphenyl]-3,3,6,6-tetramethyl-10-(2-phenylethyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCc3ccccc3)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C41H43N3O8/c1-7-11-26-18-27(19-35(51-6)39(26)52-34-15-14-28(43(47)48)20-29(34)44(49)50)36-37-30(21-40(2,3)23-32(37)45)42(17-16-25-12-9-8-10-13-25)31-22-41(4,5)24-33(46)38(31)36/h7-10,12-15,18-20,36H,1,11,16-17,21-24H2,2-6H3 |
| InChIKey | HNFNIUVEPPPCAT-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.81 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|