C38H45N3O9 — CID 126084718
9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126084718) has the molecular formula C38H45N3O9 and a molecular weight of 687.79 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126084718 |
| Molecular Formula | C38H45N3O9 |
| Molecular Weight | 687.79 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C38H45N3O9/c1-8-11-23-16-24(17-32(49-9-2)36(23)50-31-13-12-25(40(44)45)18-26(31)41(46)47)33-34-27(19-37(3,4)21-29(34)42)39(14-10-15-48-7)28-20-38(5,6)22-30(43)35(28)33/h8,12-13,16-18,33H,1,9-11,14-15,19-22H2,2-7H3 |
| InChIKey | BTMWOODIICCWGN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.79 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|