C34H38IN3O9 — CID 126092597
9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126092597) has the molecular formula C34H38IN3O9 and a molecular weight of 759.59 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126092597 |
| Molecular Formula | C34H38IN3O9 |
| Molecular Weight | 759.59 g/mol |
| Exact Mass | 759.17 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)-3-iodo-5-methoxyphenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2cc(I)c(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C34H38IN3O9/c1-33(2)15-23-30(25(39)17-33)29(31-24(36(23)10-7-11-45-5)16-34(3,4)18-26(31)40)19-12-21(35)32(28(13-19)46-6)47-27-9-8-20(37(41)42)14-22(27)38(43)44/h8-9,12-14,29H,7,10-11,15-18H2,1-6H3 |
| InChIKey | YTONQBXDJZXACS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|