C35H39F3N2O7 — CID 126095558
9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126095558) has the molecular formula C35H39F3N2O7 and a molecular weight of 656.70 g/mol. Its IUPAC name is 9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126095558 |
| Molecular Formula | C35H39F3N2O7 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C35H39F3N2O7/c1-33(2)16-23-31(25(41)18-33)30(32-24(39(23)12-7-13-45-5)17-34(3,4)19-26(32)42)20-8-10-28(29(14-20)46-6)47-27-11-9-21(35(36,37)38)15-22(27)40(43)44/h8-11,14-15,30H,7,12-13,16-19H2,1-6H3 |
| InChIKey | HYKTURSDZMQIAH-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|