C29H27F3N2O6 — CID 126094629
10-ethyl-9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 126094629) has the molecular formula C29H27F3N2O6 and a molecular weight of 556.54 g/mol. Its IUPAC name is 10-ethyl-9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-ethyl-9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126094629 |
| Molecular Formula | C29H27F3N2O6 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 10-ethyl-9-[3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | CCN1C2=C(C(=O)CCC2)C(c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)C2=C1CCCC2=O |
| InChI | InChI=1S/C29H27F3N2O6/c1-3-33-18-6-4-8-21(35)27(18)26(28-19(33)7-5-9-22(28)36)16-10-12-24(25(14-16)39-2)40-23-13-11-17(29(30,31)32)15-20(23)34(37)38/h10-15,26H,3-9H2,1-2H3 |
| InChIKey | WMPVQAMHQULPAF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|