C26H21F3N2O5 — CID 126099335
9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 126099335) has the molecular formula C26H21F3N2O5 and a molecular weight of 498.46 g/mol. Its IUPAC name is 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126099335 |
| Molecular Formula | C26H21F3N2O5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C26H21F3N2O5/c27-26(28,29)15-10-11-22(19(13-15)31(34)35)36-16-5-1-4-14(12-16)23-24-17(6-2-8-20(24)32)30-18-7-3-9-21(33)25(18)23/h1,4-5,10-13,23,30H,2-3,6-9H2 |
| InChIKey | YIMWZIIHIRNYJM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|