C26H20F3NO6 — CID 126084114
9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126084114) has the molecular formula C26H20F3NO6 and a molecular weight of 499.44 g/mol. Its IUPAC name is 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126084114 |
| Molecular Formula | C26H20F3NO6 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 9-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c1)C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C26H20F3NO6/c27-26(28,29)15-10-11-20(17(13-15)30(33)34)35-16-5-1-4-14(12-16)23-24-18(31)6-2-8-21(24)36-22-9-3-7-19(32)25(22)23/h1,4-5,10-13,23H,2-3,6-9H2 |
| InChIKey | GAIGKGJLFPBMKH-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|