C25H20N2O8 — CID 126083156
9-[2-(2,4-dinitrophenoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126083156) has the molecular formula C25H20N2O8 and a molecular weight of 476.44 g/mol. Its IUPAC name is 9-[2-(2,4-dinitrophenoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[2-(2,4-dinitrophenoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126083156 |
| Molecular Formula | C25H20N2O8 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 9-[2-(2,4-dinitrophenoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1=C(CCCC1=O)O2 |
| InChI | InChI=1S/C25H20N2O8/c28-17-6-3-9-21-24(17)23(25-18(29)7-4-10-22(25)35-21)15-5-1-2-8-19(15)34-20-12-11-14(26(30)31)13-16(20)27(32)33/h1-2,5,8,11-13,23H,3-4,6-7,9-10H2 |
| InChIKey | CHDURPURUWIESC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|