C25H21N3O7 — CID 126084134
9-[4-(2,4-dinitrophenoxy)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 126084134) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126084134 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)phenyl]-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C25H21N3O7/c29-20-5-1-3-17-24(20)23(25-18(26-17)4-2-6-21(25)30)14-7-10-16(11-8-14)35-22-12-9-15(27(31)32)13-19(22)28(33)34/h7-13,23,26H,1-6H2 |
| InChIKey | GSIAWBOXZYEAKM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|