C29H29N3O7 — CID 126099574
9-[4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione (PubChem CID 126099574) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 126099574 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)phenyl]-3,3,6,6-tetramethyl-2,4,5,7,9,10-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)(C)C1)C2c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H29N3O7/c1-28(2)12-19-26(22(33)14-28)25(27-20(30-19)13-29(3,4)15-23(27)34)16-5-8-18(9-6-16)39-24-10-7-17(31(35)36)11-21(24)32(37)38/h5-11,25,30H,12-15H2,1-4H3 |
| InChIKey | YDCCJHXBDYDHSW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|