C32H34ClN3O8 — CID 126097255
9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126097255) has the molecular formula C32H34ClN3O8 and a molecular weight of 624.09 g/mol. Its IUPAC name is 9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126097255 |
| Molecular Formula | C32H34ClN3O8 |
| Molecular Weight | 624.09 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | 9-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | COCCN1C2=C(C(=O)CC(C)(C)C2)C(c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Cl)c2)C2=C1CC(C)(C)CC2=O |
| InChI | InChI=1S/C32H34ClN3O8/c1-31(2)14-22-29(24(37)16-31)28(30-23(34(22)10-11-43-5)15-32(3,4)17-25(30)38)18-6-8-26(20(33)12-18)44-27-9-7-19(35(39)40)13-21(27)36(41)42/h6-9,12-13,28H,10-11,14-17H2,1-5H3 |
| InChIKey | RGOFNGREBLYUNV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.09 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|