C37H43N3O9 — CID 126095488
9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126095488) has the molecular formula C37H43N3O9 and a molecular weight of 673.76 g/mol. Its IUPAC name is 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126095488 |
| Molecular Formula | C37H43N3O9 |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 9-[4-(2,4-dinitrophenoxy)-3-ethoxy-5-prop-2-enylphenyl]-10-(2-methoxyethyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCOC)C3=C2C(=O)CC(C)(C)C3)cc(OCC)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C37H43N3O9/c1-8-10-22-15-23(16-31(48-9-2)35(22)49-30-12-11-24(39(43)44)17-25(30)40(45)46)32-33-26(18-36(3,4)20-28(33)41)38(13-14-47-7)27-19-37(5,6)21-29(42)34(27)32/h8,11-12,15-17,32H,1,9-10,13-14,18-21H2,2-7H3 |
| InChIKey | LXSBCYZGDMPZRL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|