C33H45NO5 — CID 126072067
10-(2-methoxyethyl)-9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 126072067) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is 10-(2-methoxyethyl)-9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(2-methoxyethyl)-9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 126072067 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 10-(2-methoxyethyl)-9-(3-methoxy-5-prop-2-enyl-4-propoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCOC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OCCC |
| InChI | InChI=1S/C33H45NO5/c1-9-11-21-15-22(16-27(38-8)31(21)39-13-10-2)28-29-23(17-32(3,4)19-25(29)35)34(12-14-37-7)24-18-33(5,6)20-26(36)30(24)28/h9,15-16,28H,1,10-14,17-20H2,2-8H3 |
| InChIKey | IUIAKOIZPXYVPV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|