C37H45NO6S — CID 126070005
[2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate (PubChem CID 126070005) has the molecular formula C37H45NO6S and a molecular weight of 631.84 g/mol. Its IUPAC name is [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126070005 |
| Molecular Formula | C37H45NO6S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | [2-methoxy-6-prop-2-enyl-4-(3,3,6,6-tetramethyl-1,8-dioxo-10-propyl-4,5,7,9-tetrahydro-2H-acridin-9-yl)phenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCC)C3=C2C(=O)CC(C)(C)C3)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H45NO6S/c1-9-11-24-17-25(18-31(43-8)35(24)44-45(41,42)26-14-12-23(3)13-15-26)32-33-27(19-36(4,5)21-29(33)39)38(16-10-2)28-20-37(6,7)22-30(40)34(28)32/h9,12-15,17-18,32H,1,10-11,16,19-22H2,2-8H3 |
| InChIKey | CZELOIJNYMFEAH-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|