C31H33NO6S — CID 126082354
[4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126082354) has the molecular formula C31H33NO6S and a molecular weight of 547.67 g/mol. Its IUPAC name is [4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126082354 |
| Molecular Formula | C31H33NO6S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [4-(10-ethyl-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl)-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)N(CC)C3=C2C(=O)CCC3)cc(OC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H33NO6S/c1-4-11-20-18-21(19-27(37-3)31(20)38-39(35,36)22-12-7-6-8-13-22)28-29-23(14-9-16-25(29)33)32(5-2)24-15-10-17-26(34)30(24)28/h4,6-8,12-13,18-19,28H,1,5,9-11,14-17H2,2-3H3 |
| InChIKey | ZZGBQYFDWYPGHY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|