C24H26O5 — CID 126081482
9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 126081482) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 126081482 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 9-(3,4-dimethoxy-5-prop-2-enylphenyl)-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | C=CCc1cc(C2C3=C(CCCC3=O)OC3=C2C(=O)CCC3)cc(OC)c1OC |
| InChI | InChI=1S/C24H26O5/c1-4-7-14-12-15(13-20(27-2)24(14)28-3)21-22-16(25)8-5-10-18(22)29-19-11-6-9-17(26)23(19)21/h4,12-13,21H,1,5-11H2,2-3H3 |
| InChIKey | URGAJEOMNZERSG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|